![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | cours.rar | 2023-05-18 13:42 | 24M | |
![[ ]](/icons/compressed.gif) | Cours1_APPAREILLAGE ÉLECTRIQUE INDUSTRIEL.zip | 2020-12-03 21:21 | 18M | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Com2.rar | 2021-04-04 10:55 | 17M | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Com2 (2).rar | 2021-04-03 21:22 | 17M | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Com2 (1).rar | 2021-04-03 21:22 | 17M | |
![[ ]](/icons/unknown.gif) | TDs lts.rar | 2023-05-18 13:42 | 17M | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM-GPL_Maths2-TD_integration_Partie3.pdf | 2021-04-03 21:46 | 17M | |
![[ ]](/icons/layout.gif) | Cours ELECTRONIQUE I_2.pdf | 2021-04-03 21:06 | 16M | |
![[ ]](/icons/unknown.gif) | MDF.rar | 2022-03-15 09:13 | 11M | |
![[ ]](/icons/layout.gif) | Cours AUTO3.pdf | 2021-04-03 20:59 | 9.2M | |
![[ ]](/icons/layout.gif) | Mécanique1 (1ére Année GPL + LTS) Chapite1 Outils Mathématiques.pdf | 2020-12-06 11:22 | 9.1M | |
![[ ]](/icons/layout.gif) | Cours Electronique II.pdf | 2021-04-03 21:05 | 8.7M | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM-GPL_Exercices Intégrales.pdf | 2021-04-03 21:28 | 8.3M | |
![[ ]](/icons/unknown.gif) | TPs informatique (Excel).rar | 2021-04-04 10:48 | 8.3M | |
![[ ]](/icons/unknown.gif) | les cours+TD+TP de L3 PMI.rar | 2021-01-22 20:30 | 8.1M | |
![[ ]](/icons/unknown.gif) | securite 2 3EM PMI.docx | 2021-12-08 13:50 | 7.9M | |
![[ ]](/icons/layout.gif) | L2-PMI et GIM_Maths 4- TD 2-Série numériques.pdf | 2021-04-03 21:59 | 7.4M | |
![[ ]](/icons/layout.gif) | CamScanner 05-08-2020 00.59.31.pdf | 2021-01-26 08:42 | 7.4M | |
![[ ]](/icons/unknown.gif) | Polycopié RDM Final 2022.rar | 2022-03-22 08:17 | 7.2M | |
![[ ]](/icons/layout.gif) | L1-GPL_Corrigé TD 04 Méca2 GPL.pdf | 2021-04-03 21:11 | 7.0M | |
![[ ]](/icons/compressed.gif) | L2-GIM_MécaFluides-TD.zip | 2021-04-03 21:57 | 6.5M | |
![[ ]](/icons/layout.gif) | L3-GIM_Cours_Meca-Rupture_3eme_GIM_S6.pdf | 2021-04-03 22:08 | 6.2M | |
![[ ]](/icons/layout.gif) | Cours_Meca-Rupture_3eme_PMI_S5.pdf | 2021-02-10 11:25 | 6.2M | |
![[ ]](/icons/layout.gif) | Polycopié_fedaoui.pdf | 2021-01-30 10:36 | 6.1M | |
![[ ]](/icons/layout.gif) | Microsoft Office (Word).pdf | 2021-04-03 22:18 | 6.1M | |
![[ ]](/icons/layout.gif) | Microsoft Office (Word) (2).pdf | 2021-04-03 22:16 | 6.1M | |
![[ ]](/icons/layout.gif) | Microsoft Office (Word) (1).pdf | 2021-04-03 22:16 | 6.1M | |
![[ ]](/icons/unknown.gif) | Chapitre 1CNDgim2.docx | 2021-12-08 13:50 | 5.9M | |
![[ ]](/icons/layout.gif) | L1-GPL_solution TD N°03 meca 2.pdf | 2021-04-06 09:58 | 5.5M | |
![[ ]](/icons/unknown.gif) | Systeme H & P 1 GIM.docx | 2022-03-23 10:26 | 4.9M | |
![[ ]](/icons/unknown.gif) | Systeme H & P INTRO et Chapi II.docx | 2021-12-05 10:04 | 4.9M | |
![[ ]](/icons/unknown.gif) | cours fab4.rar | 2022-01-19 13:36 | 4.6M | |
![[ ]](/icons/unknown.gif) | Convection et rayonnement-converti.rar | 2021-05-02 11:41 | 4.2M | |
![[ ]](/icons/layout.gif) | L1-PMI et GPL_Fab3_Bureau Des Méthodes.pdf | 2021-04-03 21:15 | 4.0M | |
![[ ]](/icons/layout.gif) | Fab3_Bureau Des Méthodes.pdf | 2021-04-06 11:19 | 4.0M | |
![[ ]](/icons/unknown.gif) | L1-GIM_Transfert Thermique-TD.rar | 2021-04-03 21:10 | 3.9M | |
![[ ]](/icons/layout.gif) | L1-GPL_cours métrologie 1.pdf | 2021-04-06 11:17 | 3.8M | |
![[ ]](/icons/unknown.gif) | cours conduction.rar | 2021-05-02 11:40 | 3.7M | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM et GPL_Maths2-TD_integration_Partie1.pdf | 2021-04-03 21:16 | 3.7M | |
![[ ]](/icons/layout.gif) | L2-PMI et GIM_Maths 4- TD 3- Série de fourrier.pdf | 2021-04-03 22:00 | 3.6M | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM-GPL_Maths 2-TD_integration_Partie2.pdf | 2021-04-03 21:30 | 3.5M | |
![[ ]](/icons/unknown.gif) | CHAP5 cours+TD Machines synchrone.rar | 2021-02-10 10:34 | 3.4M | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Org.Entreprise.rar | 2021-04-03 21:46 | 3.4M | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Org.Entreprise (1).rar | 2021-04-06 09:53 | 3.4M | |
![[ ]](/icons/layout.gif) | présentation générale Materiaux.pdf | 2021-01-16 15:54 | 3.3M | |
![[ ]](/icons/layout.gif) | Cours_M_Rupture_3eme_GIM_S6 [Mode de compatibilité].pdf | 2021-04-03 21:07 | 3.2M | |
![[ ]](/icons/unknown.gif) | L3-GIM_Sécurité2.rar | 2021-04-06 09:54 | 3.1M | |
![[ ]](/icons/unknown.gif) | L3-GIM_Sécurité2 (1).rar | 2021-04-03 22:11 | 3.1M | |
![[ ]](/icons/layout.gif) | L1-GIM_ELT1_CHAP2.pdf | 2021-04-03 21:09 | 3.0M | |
![[ ]](/icons/layout.gif) | moulage.pdf | 2021-02-14 09:54 | 3.0M | |
![[ ]](/icons/layout.gif) | Sécurité 1er Année PMI & LTS 1.pdf | 2022-12-05 08:11 | 3.0M | |
![[ ]](/icons/layout.gif) | Polycopié-automatisme-bouchahed_A.pdf | 2021-11-10 08:03 | 2.8M | |
![[ ]](/icons/unknown.gif) | auto 2.rar | 2021-01-26 08:28 | 2.8M | |
![[ ]](/icons/unknown.gif) | pneumatique et hydraulique.rar | 2021-01-26 08:37 | 2.8M | |
![[ ]](/icons/layout.gif) | Cours_CND_2018_L3_PMI.pdf | 2021-02-10 11:22 | 2.8M | |
![[ ]](/icons/layout.gif) | Cours Métrologie S02.pdf | 2021-04-03 21:06 | 2.7M | |
![[ ]](/icons/layout.gif) | Partie I( conception mécanique).pdf | 2021-04-03 22:17 | 2.7M | |
![[ ]](/icons/layout.gif) | cours2_SCHÉMAS ET NORMES DES INSTALLATIONS ÉLECTRIQUES.pdf | 2020-12-07 22:39 | 2.7M | |
![[ ]](/icons/unknown.gif) | cours fab5.rar | 2022-01-19 13:39 | 2.7M | |
![[ ]](/icons/layout.gif) | TD Demarche qualite_L2-GIM.pdf | 2021-04-03 22:20 | 2.6M | |
![[ ]](/icons/layout.gif) | TD Demarche qualite_L2-GIM (1).pdf | 2021-04-03 22:20 | 2.6M | |
![[ ]](/icons/unknown.gif) | FAB 2 Mises-en Œuvre des Moyens de Production 1er P¨MI.rar | 2021-04-04 10:43 | 2.6M | |
![[ ]](/icons/layout.gif) | Chapitre 4 Généralités sur la construction des mécanismes et la schématisation.pdf | 2021-01-26 08:51 | 2.6M | |
![[ ]](/icons/layout.gif) | Organisation-Entreprise.pdf | 2021-04-21 12:01 | 2.6M | |
![[ ]](/icons/layout.gif) | TP N01 MATLAB 2éme année PMI et GPL.pdf | 2020-12-02 00:36 | 2.6M | |
![[ ]](/icons/layout.gif) | Cours - Pilotage et implantation atelier.pdf | 2022-04-20 11:59 | 2.5M | |
![[ ]](/icons/unknown.gif) | TPs Métrologie.rar | 2021-04-04 10:48 | 2.5M | |
![[ ]](/icons/unknown.gif) | cours omm.rar | 2023-05-25 11:28 | 2.5M | |
![[ ]](/icons/layout.gif) | L1 - GPL_Cours numéro 01 La qualité.pdf | 2021-01-16 15:37 | 2.5M | |
![[ ]](/icons/unknown.gif) | L2-PMI_TP Dessin Industriel 4-CAO.rar | 2021-04-06 09:58 | 2.4M | |
![[ ]](/icons/unknown.gif) | TPs 2émé année PMI.rar | 2021-04-03 22:21 | 2.4M | |
![[ ]](/icons/layout.gif) | L1-GPL_Gestion de production, GP cours+TD.pdf | 2021-04-03 21:13 | 2.3M | |
![[ ]](/icons/unknown.gif) | L2-PMI et GIM_ Anglais.rar | 2021-04-06 10:20 | 2.3M | |
![[ ]](/icons/unknown.gif) | English2.rar | 2021-01-22 20:46 | 2.3M | |
![[ ]](/icons/unknown.gif) | L3-GIM_TD MECA7.rar | 2021-04-03 22:12 | 2.2M | |
![[ ]](/icons/unknown.gif) | L3-GIM_TD MECA7 (1).rar | 2021-04-03 22:11 | 2.2M | |
![[ ]](/icons/layout.gif) | L3-GIM_Opérations Maintenance 2_TP_2_opm2.pdf | 2021-04-03 22:09 | 2.1M | |
![[ ]](/icons/unknown.gif) | TD SYSTEM H.rar | 2022-01-17 14:04 | 2.1M | |
![[ ]](/icons/unknown.gif) | TD AUTO2.rar | 2022-01-17 14:04 | 2.1M | |
![[ ]](/icons/unknown.gif) | Electronique 2.rar | 2021-04-21 11:47 | 2.1M | |
![[ ]](/icons/unknown.gif) | cours AUTO3.rar | 2020-12-06 12:19 | 2.0M | |
![[ ]](/icons/unknown.gif) | PPP 03.rar | 2020-12-26 22:36 | 2.0M | |
![[ ]](/icons/unknown.gif) | Module Machine Thermique et Maintenance Immobiliere.rar | 2022-03-15 09:12 | 2.0M | |
![[ ]](/icons/layout.gif) | optimisation des condition de coupe.pdf | 2021-02-08 08:25 | 1.9M | |
![[ ]](/icons/layout.gif) | TIG Aluminium.pdf | 2022-03-23 08:57 | 1.9M | |
![[ ]](/icons/layout.gif) | MATHS 1 partie 2.pdf | 2021-01-30 10:56 | 1.9M | |
![[ ]](/icons/layout.gif) | TP1 DAO.ppt1.pdf | 2020-12-10 10:49 | 1.9M | |
![[ ]](/icons/layout.gif) | TD-1-et-2-optimisation-pour-3ème-année-PMI.pdf | 2020-12-07 20:02 | 1.9M | |
![[ ]](/icons/compressed.gif) | L1-PMI_Dessin 2 ( Cours et TD).zip | 2021-04-04 10:13 | 1.9M | |
![[ ]](/icons/compressed.gif) | Dessin 2 ( Cours et TD) 1PMI 2020.zip | 2021-04-04 10:14 | 1.9M | |
![[ ]](/icons/unknown.gif) | L2-PMI_TP FAB 8.rar | 2021-04-06 09:58 | 1.9M | |
![[ ]](/icons/unknown.gif) | PPP 01.rar | 2020-12-26 22:36 | 1.9M | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-cours2_Réseaux Industriels de Communication.pdf | 2021-04-06 14:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | CHAP4 cours+TD MCC PMI L3.rar | 2021-01-30 10:47 | 1.8M | |
![[ ]](/icons/unknown.gif) | L2-PMI_TP1-2-3_Conception Mécanique.rar | 2021-04-06 09:53 | 1.8M | |
![[ ]](/icons/unknown.gif) | L2-PMI_TP1-2-3_Conception Mécanique (1).rar | 2021-04-03 22:04 | 1.8M | |
![[ ]](/icons/layout.gif) | L2 GPL_Diapo N° 1 - GPAO.pdf | 2021-04-04 11:07 | 1.8M | |
![[ ]](/icons/layout.gif) | Chapitre 2 Projection orthogonale -Dessin industriel 1-.pdf | 2021-01-02 10:31 | 1.8M | |
![[ ]](/icons/layout.gif) | Machines synchrones.pdf | 2020-12-09 10:29 | 1.8M | |
![[ ]](/icons/layout.gif) | L1-GPL_Cours Conception Mécanique 1 (partie 2).pdf | 2021-04-06 13:37 | 1.8M | |
![[ ]](/icons/layout.gif) | L2-PMI et GIM_Maths 4-loi normale.pdf | 2021-04-03 22:01 | 1.8M | |
![[ ]](/icons/unknown.gif) | L2-PMI_TP_Fab6.rar | 2021-04-03 22:06 | 1.7M | |
![[ ]](/icons/layout.gif) | Chapitre 1_introduction sur le soudage.pdf | 2022-03-02 13:32 | 1.7M | |
![[ ]](/icons/layout.gif) | 6-chp3-stock-fonction-6.pdf | 2021-02-17 08:41 | 1.7M | |
![[ ]](/icons/layout.gif) | Cours1_Étude technologique du câblage industriel.pdf | 2020-12-03 21:52 | 1.6M | |
![[ ]](/icons/layout.gif) | Module_Dessinindustriel Chapitre2.pdf | 2020-12-07 22:47 | 1.6M | |
![[ ]](/icons/layout.gif) | Module_Dessinindustriel Chapitre2.pdf | 2021-04-21 12:18 | 1.6M | |
![[ ]](/icons/layout.gif) | Module_Dessinindustriel Chapitre2.pdf | 2021-05-16 10:03 | 1.6M | |
![[ ]](/icons/layout.gif) | LA NORME NF C 15-100_3_4.pdf | 2020-12-14 10:19 | 1.6M | |
![[ ]](/icons/layout.gif) | L3-GIM_TP - GMAO.pdf | 2021-04-03 22:13 | 1.5M | |
![[ ]](/icons/layout.gif) | engineering_terms.pdf | 2021-04-04 11:03 | 1.5M | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-cours1_Programmation des API.pdf | 2021-04-06 14:37 | 1.5M | |
![[ ]](/icons/layout.gif) | Cours ResistancedesMateriaux septembre 1.pdf | 2021-04-04 10:04 | 1.5M | |
![[ ]](/icons/layout.gif) | Contrôle de la conformité_1er_GPL_S2.pdf | 2024-12-01 12:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | L2-GIM_Cablage et Maint. Syst.Electriques-TP_1_2_3_CMSE3_S4GIM.rar | 2021-04-03 21:49 | 1.4M | |
![[ ]](/icons/layout.gif) | les liaisons non permanentes (ASSEMBLAGES) Ch 04 1er Année GPL.pdf | 2021-04-06 11:19 | 1.4M | |
![[ ]](/icons/layout.gif) | L1-GPL_Les liaisons non permanentes (ASSEMBLAGES) Ch 04 1er Année GPL.pdf | 2021-04-06 11:16 | 1.4M | |
![[ ]](/icons/layout.gif) | Chapitre3 Algèbre de Boole 3ème séance Mardi 08_12_20 PMI et TS S1 .pdf | 2020-12-07 18:58 | 1.4M | |
![[ ]](/icons/layout.gif) | Chapitre3 Algèbre de Boole 3ème séance Mardi 08_12_20 PMI et TS S1 .pdf | 2020-12-07 09:35 | 1.4M | |
![[ ]](/icons/layout.gif) | TP3 Essai de dureté 2021.pdf | 2021-06-06 10:53 | 1.4M | |
![[ ]](/icons/unknown.gif) | L1-PMI et GPL_FAB3-TD et TP BDM.rar | 2021-04-03 21:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Cours 3.pdf | 2021-01-06 22:32 | 1.4M | |
![[ ]](/icons/layout.gif) | chapitre-4.pdf | 2021-01-06 22:22 | 1.3M | |
![[ ]](/icons/unknown.gif) | L2-PMI_TP1-2-3_MECA4.rar | 2021-04-06 09:48 | 1.3M | |
![[ ]](/icons/compressed.gif) | Chapitre 1 Introduction aux systèmes automatisés première séance Mardi 01_12_20 PMI et TS S1.zip | 2020-12-01 23:23 | 1.3M | |
![[ ]](/icons/layout.gif) | Chapitre 1 Généralités sur le dessin industriel.pdf | 2021-01-02 10:30 | 1.3M | |
![[ ]](/icons/layout.gif) | Chapitre 1 Généralités sur le dessin industriel2.pdf | 2020-12-15 09:38 | 1.3M | |
![[ ]](/icons/layout.gif) | chapitre1 Generalités.pdf | 2020-12-03 21:35 | 1.3M | |
![[ ]](/icons/layout.gif) | L2 GPL et L3 PMI_PILOTAGE ET REVUE DE PROCESSUS.pdf | 2021-01-16 15:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Chapitre 4 assemblage thermique 2022.pdf | 2022-03-15 09:08 | 1.3M | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-cours5_modbus.pdf | 2021-04-06 14:38 | 1.3M | |
![[ ]](/icons/layout.gif) | COURS_Soudage_TIG(1).pdf | 2022-03-22 08:16 | 1.3M | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 Chapitre 5 Les méthodes fréquentielles.pdf | 2021-04-03 22:01 | 1.3M | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 Chapitre 5 Les méthodes fréquentielles (1).pdf | 2021-04-03 22:01 | 1.3M | |
![[ ]](/icons/layout.gif) | L3-GIM_Opérations de maintenance 2-TP_6_opm2.pdf | 2021-04-03 22:08 | 1.2M | |
![[ ]](/icons/layout.gif) | chapitre 3_algèbre_de-boole.pdf | 2020-12-26 23:01 | 1.2M | |
![[ ]](/icons/layout.gif) | Chapitre 3 Sections et coupes.pdf | 2021-01-19 08:53 | 1.2M | |
![[ ]](/icons/layout.gif) | Cours FAB 7.pdf | 2021-04-03 21:05 | 1.2M | |
![[ ]](/icons/layout.gif) | Chapitre-2_SYSTEMES DE NUMERATION ET CODAGE.pdf | 2021-04-06 14:13 | 1.2M | |
![[ ]](/icons/layout.gif) | L3-GIM_TP1+TD1Organisation de maintenance 2.pdf | 2021-04-03 22:13 | 1.2M | |
![[ ]](/icons/layout.gif) | L3-GIM_TP1+TD1Organisation de maintenance 2 (1).pdf | 2021-04-03 22:13 | 1.2M | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-cours4_Profibus.pdf | 2021-04-06 14:38 | 1.2M | |
![[ ]](/icons/layout.gif) | L1-PMI_Cours fab 2 Soudage .pdf | 2021-04-03 21:48 | 1.2M | |
![[ ]](/icons/unknown.gif) | GaP.rar | 2021-12-08 13:49 | 1.2M | |
![[ ]](/icons/layout.gif) | Cours L3_GIM-Comment lire et comprendre un bilan.pdf | 2021-04-03 21:06 | 1.2M | |
![[ ]](/icons/layout.gif) | Cours-TD-Meca6- Debbah Younes.pdf | 2021-04-03 21:15 | 1.2M | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-cours3_Ethernet Industriel.pdf | 2021-04-03 22:09 | 1.2M | |
![[ ]](/icons/layout.gif) | L3-GIM-Réseau Automate_cours3_Ethernet Industriel.pdf | 2021-04-03 22:06 | 1.2M | |
![[ ]](/icons/layout.gif) | TD_4_Meca7_GIM_3eme.pdf | 2021-05-31 10:24 | 1.2M | |
![[ ]](/icons/layout.gif) | TD_4_Meca7_.pdf | 2022-01-18 07:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | L1-PMI_Electricité 1.rar | 2021-04-03 21:48 | 1.1M | |
![[ ]](/icons/compressed.gif) | Matériaux2 (Cours et TD) 1PMI et 1GIM 2020.zip | 2021-04-04 10:13 | 1.1M | |
![[ ]](/icons/compressed.gif) | L1-PMI-GIM_Matériaux2 (Cours et TD).zip | 2021-04-04 10:13 | 1.1M | |
![[ ]](/icons/layout.gif) | soudage sous flux (solide) en poudre 1.pdf | 2022-04-18 12:52 | 1.1M | |
![[ ]](/icons/layout.gif) | Chapter_1_papier_02.pdf | 2023-10-03 08:15 | 1.1M | |
![[ ]](/icons/unknown.gif) | PPP 01 1ère année PMI et GPL.rar | 2020-12-02 00:36 | 1.1M | |
![[ ]](/icons/unknown.gif) | L2_GPL- Gestion de la qualité et L3_PMI-Management de la qualité.rar | 2021-02-10 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | TD_3_Meca7_GIM_3eme.pdf | 2022-01-18 07:42 | 1.1M | |
![[ ]](/icons/layout.gif) | TD_3_Meca7.pdf | 2022-01-18 07:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Chapitre 2 Les risques professionnels .pdf | 2021-05-16 09:53 | 1.1M | |
![[ ]](/icons/unknown.gif) | fascicule_hygiene_securite word COURS 2.docx | 2021-11-09 09:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Chapitre 2 Les risques professionnels.pdf | 2021-04-21 12:11 | 1.1M | |
![[ ]](/icons/layout.gif) | Exos-Duree De Vie Roulements.pdf | 2021-02-28 10:13 | 1.1M | |
![[ ]](/icons/layout.gif) | Schémas de Liaison à la Terre.pdf | 2021-04-03 22:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Cours 2 MOYENS DE PRODUCTION,.... (Production et industrialisation)(GPL-S1).pdf | 2020-12-14 09:44 | 1.0M | |
![[ ]](/icons/layout.gif) | L1-PMI et GIM_TD 1 Meca 2 +solution.pdf | 2021-04-04 10:10 | 1.0M | |
![[ ]](/icons/layout.gif) | LA NORME NF C 15-100_1_2.pdf | 2020-12-14 10:19 | 1.0M | |
![[ ]](/icons/layout.gif) | L1-GPL_Cours Conception Mécanique 1 (partie 1).pdf | 2021-04-06 11:19 | 1.0M | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-TP2_AR.pdf | 2021-04-06 14:37 | 1.0M | |
![[ ]](/icons/layout.gif) | Cours 2 pour 1ère année PMI FAB 1.pdf | 2020-12-09 10:28 | 1.0M | |
![[ ]](/icons/layout.gif) | BOUSSAID_Cours.pdf | 2021-04-03 20:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Cours ORDONNANCEMENT D'ATELIER 1 (partie 1).pdf | 2021-04-21 12:06 | 1.0M | |
![[ ]](/icons/layout.gif) | L1-GIM_ELectrotechnique1.pdf | 2021-04-03 21:08 | 1.0M | |
![[ ]](/icons/layout.gif) | auto-5-chapitre-7_les correcteur-PID.pdf | 2021-04-03 20:54 | 1.0M | |
![[ ]](/icons/layout.gif) | L3-GIM_Auto-5-chapitre-7_les correcteur-PID.pdf | 2021-04-03 22:06 | 1.0M | |
![[ ]](/icons/layout.gif) | Désignation des materiaux_.pdf | 2021-01-22 20:20 | 1.0M | |
![[ ]](/icons/layout.gif) | Chapitre 2 Les risques professionnels.pdf | 2020-12-08 08:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Corrige Exos Duree De Vie Roulements.pdf | 2021-02-28 10:13 | 1.0M | |
![[ ]](/icons/layout.gif) | Cours 2-Electricité 1-Énergie et puissance électrique.pdf | 2020-12-06 20:49 | 972K | |
![[ ]](/icons/unknown.gif) | Cours et TD CONCEPTION MECANIQUE 1.rar | 2021-01-26 08:46 | 964K | |
![[ ]](/icons/layout.gif) | L3-GIM_Opérations Maintenance 2_TP_3_opm2.pdf | 2021-04-03 22:09 | 962K | |
![[ ]](/icons/layout.gif) | performances-systèmes-asservis-3ème-GIM.pdf | 2021-04-03 22:18 | 960K | |
![[ ]](/icons/layout.gif) | performances-systèmes-asservis-3ème-GIM (1).pdf | 2021-04-03 22:17 | 960K | |
![[ ]](/icons/layout.gif) | chapitre 2_ soudag OA.pdf | 2022-03-02 13:32 | 947K | |
![[ ]](/icons/layout.gif) | Entretient et Dépannage des Machines Électriques.pdf | 2021-04-03 21:08 | 944K | |
![[ ]](/icons/unknown.gif) | L1_GPL_Introduction à la Qualité.rar | 2021-02-10 11:31 | 939K | |
![[ ]](/icons/layout.gif) | TD_Economie_L3-GIM.pdf | 2021-04-03 22:20 | 938K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 Chapitre 6 Synthèse des contrôleurs .pdf | 2021-04-03 22:01 | 937K | |
![[ ]](/icons/layout.gif) | Chapitre 3 Sections et Coupes.pdf | 2021-05-16 10:03 | 936K | |
![[ ]](/icons/layout.gif) | Exercices corrigésThermo Global.pdf | 2021-01-26 08:48 | 930K | |
![[ ]](/icons/layout.gif) | FIABILITÉ Chapitre1- F-CH1 jeudi 03-12-2020.pdf | 2020-12-02 01:04 | 928K | |
![[ ]](/icons/layout.gif) | Cours 1 L’INDUSTRIALISATION (Production et industrialisation)(GPL-S1).pdf | 2020-12-07 10:03 | 926K | |
![[ ]](/icons/layout.gif) | Chapitre 1 Classes des materiaux 2020.pdf | 2021-01-02 10:24 | 925K | |
![[ ]](/icons/layout.gif) | L3-GIM_Opérations de maintenance 2-TP_4_opm2.pdf | 2021-04-03 22:07 | 919K | |
![[ ]](/icons/layout.gif) | L1-PMI_AUTO 3 TD 7 Correcteurs Solution.pdf | 2021-04-03 21:47 | 918K | |
![[ ]](/icons/layout.gif) | Cours + TD MCC.pdf | 2020-12-02 00:14 | 916K | |
![[ ]](/icons/layout.gif) | L3-GIM_Opérations de maintenance 2-TP_5_opm2.pdf | 2021-04-03 22:08 | 913K | |
![[ ]](/icons/layout.gif) | cours omm2.pdf | 2021-05-04 11:49 | 913K | |
![[ ]](/icons/layout.gif) | Chapitre4 Les Systèmes Logique Combinatoires 4ème séance Jeudi 10_12_20 PMI et TS S1.pdf | 2020-12-10 10:49 | 911K | |
![[ ]](/icons/layout.gif) | L1-GPL_Cours MECA 2 (ch1_ch2 et ch3).pdf | 2021-04-03 21:12 | 898K | |
![[ ]](/icons/layout.gif) | Chapitre1 Classes des materiaux2020.pdf | 2020-12-14 09:20 | 898K | |
![[ ]](/icons/layout.gif) | Méthodes de dépannage des armoires électriques.pdf | 2021-04-03 22:16 | 893K | |
![[ ]](/icons/layout.gif) | Chapitre 4 Les liaisons.pdf | 2021-04-21 11:57 | 865K | |
![[ ]](/icons/layout.gif) | Chapitre 4 Les liaisons-1.pdf | 2021-05-16 10:03 | 865K | |
![[ ]](/icons/layout.gif) | Chapitre 5 assemblages par rivets 2022.pdf | 2022-03-15 09:20 | 864K | |
![[ ]](/icons/layout.gif) | TP1 matériaux1 (1).pdf | 2021-01-03 13:42 | 861K | |
![[ ]](/icons/layout.gif) | L1-GIM_Electronique 1-TP Brochure.pdf | 2021-04-03 21:08 | 842K | |
![[ ]](/icons/layout.gif) | chapitre-1-automatisme.pdf | 2020-12-01 23:56 | 841K | |
![[ ]](/icons/layout.gif) | L1-GPL_Cours ORDONNANCEMENT D'ATELIER 1(partie 2).pdf | 2021-04-03 21:12 | 833K | |
![[ ]](/icons/unknown.gif) | MECA 1 (Chapitre 4).docx | 2020-12-14 09:39 | 831K | |
![[ ]](/icons/layout.gif) | Chapitre 4 L'incendie.pdf | 2021-05-16 09:53 | 825K | |
![[ ]](/icons/layout.gif) | L1-GPL_Méca 2-Cours ch n° 06 La Dynamique.pdf | 2021-04-06 13:37 | 823K | |
![[ ]](/icons/layout.gif) | MATHS 1.pdf | 2021-01-22 20:28 | 819K | |
![[ ]](/icons/layout.gif) | TD_TIG aluminium.pdf | 2022-03-23 08:57 | 813K | |
![[ ]](/icons/layout.gif) | AMDEC1.pdf | 2021-05-18 10:00 | 811K | |
![[ ]](/icons/layout.gif) | L1-GPL_Gestion des coûts-TP_03.pdf | 2021-04-03 21:13 | 798K | |
![[ ]](/icons/layout.gif) | 1er cours Initiation à la qualité(1).pdf | 2020-12-07 19:29 | 792K | |
![[ ]](/icons/layout.gif) | chapitre 1- Procédé de fabrication.pdf | 2020-12-02 00:03 | 785K | |
![[ ]](/icons/layout.gif) | Cours MECA 4.pdf | 2021-04-03 21:06 | 785K | |
![[ ]](/icons/layout.gif) | Chapitre 1 Généralités sur le dessin industriel.pdf | 2020-12-15 09:11 | 784K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD-7-Hydraulique-Proportionnelle.pdf | 2021-04-06 11:16 | 779K | |
![[ ]](/icons/unknown.gif) | Convection et Rayonnement.rar | 2020-12-06 21:12 | 766K | |
![[ ]](/icons/layout.gif) | 1-Déformation plastique.pdf | 2021-01-30 10:34 | 758K | |
![[ ]](/icons/layout.gif) | L3-PMI_Cours d'économie_Chap. I, II et II_04 séances.pdf | 2020-12-03 21:07 | 754K | |
![[ ]](/icons/layout.gif) | Chapitre 4 désignation des matériaux 2020.pdf | 2021-02-08 08:34 | 752K | |
![[ ]](/icons/layout.gif) | L3-GIM_TP- Opération de maintenance1.pdf | 2021-04-03 22:13 | 734K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD-11-Hydraulique proportionnelle.pdf | 2021-04-03 22:12 | 718K | |
![[ ]](/icons/layout.gif) | Cour 2 (TYPOLOGIE DES PRODUITS ET DES PROCEDES)(GPL-S1).pdf | 2020-12-09 10:27 | 715K | |
![[ ]](/icons/layout.gif) | cours5.pdf | 2021-05-18 10:04 | 714K | |
![[ ]](/icons/layout.gif) | cours 2 Rédacrion de gamme d'usinage.pdf | 2020-12-12 20:28 | 711K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD-12-Hydraulique proportionnelle.pdf | 2021-04-03 22:12 | 710K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP 02 MECA 2 (1er Année GPL) .pdf | 2021-04-03 21:13 | 702K | |
![[ ]](/icons/layout.gif) | gestion-stocks.pdf | 2021-02-17 08:37 | 700K | |
![[ ]](/icons/layout.gif) | soudage sous flux (solide) en poudre 2.pdf | 2022-04-18 12:52 | 699K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP 03 MECA 2 (1er Année GPL) .pdf | 2021-04-03 21:14 | 698K | |
![[ ]](/icons/layout.gif) | L1-GIM_TP 4 Bride à machoire_Dessin Ind.pdf | 2021-04-03 21:09 | 694K | |
![[ ]](/icons/layout.gif) | Cours 2 Les stratégies de la maintenance (Caractérisation et maintenance des moyens)(GPL-S1).pdf | 2020-12-14 09:44 | 693K | |
![[ ]](/icons/layout.gif) | L2-GIM_Conduite de projet - Support de cours.pdf | 2021-02-03 10:36 | 685K | |
![[ ]](/icons/layout.gif) | Conduite de projet - Support de cours (2).pdf | 2022-04-20 12:03 | 685K | |
![[ ]](/icons/layout.gif) | TP2 Matériaux1 2020.pdf | 2021-01-11 09:11 | 684K | |
![[ ]](/icons/layout.gif) | Chapitre 3 Les risques chimiques.pdf | 2021-05-16 09:53 | 682K | |
![[ ]](/icons/layout.gif) | Cours 2 lubrification.pdf | 2020-12-15 09:34 | 680K | |
![[ ]](/icons/layout.gif) | Cours 1-Electricité 2-Tensions et courants périodiques.pdf | 2020-12-06 11:11 | 678K | |
![[ ]](/icons/unknown.gif) | CHAPITRE 1 S par R 2 LTS.docx | 2022-03-30 10:40 | 676K | |
![[ ]](/icons/layout.gif) | TD-performances-systèmes-asservis.pdf | 2021-04-03 22:20 | 668K | |
![[ ]](/icons/layout.gif) | Cour 1 Typologie de production (TYPOLOGIE DES PRODUITS ET DES PROCEDES)(GPL-S1).pdf | 2020-12-02 00:58 | 667K | |
![[ ]](/icons/layout.gif) | TP_A_Entreprise1.pdf | 2021-05-25 14:36 | 665K | |
![[ ]](/icons/layout.gif) | TD contact oblique.pdf | 2021-02-28 10:13 | 661K | |
![[ ]](/icons/layout.gif) | Cours 1-Electricité 1-Grandeurs Electriques.pdf | 2020-12-06 11:11 | 656K | |
![[ ]](/icons/layout.gif) | Ch 4 cotation fonctionnelle 2022.pdf | 2022-03-15 09:27 | 647K | |
![[ ]](/icons/unknown.gif) | TP 1 GIM.docx | 2022-03-23 10:25 | 642K | |
![[ ]](/icons/layout.gif) | L2-PMI_Dessin industriel 4-TP 5 CAO.pdf | 2021-04-06 09:58 | 637K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD-9+10 Hydraulique proportionnlle.pdf | 2021-04-03 22:12 | 624K | |
![[ ]](/icons/layout.gif) | Cours commun 2éme année PMI & GIM.pdf | 2020-12-03 21:41 | 623K | |
![[ ]](/icons/layout.gif) | Cours Métrologie N01 (pour 1ére année PMI).pdf | 2020-12-02 00:35 | 620K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP 01 MECA 2 (1er Année GPL).pdf | 2021-04-03 21:13 | 619K | |
![[ ]](/icons/layout.gif) | Cours 1 Pour 1er Année PMI FAB 1.pdf | 2020-12-02 00:21 | 618K | |
![[ ]](/icons/layout.gif) | Chapitre 3 Diode Electronics 2.pdf | 2025-04-08 14:18 | 605K | |
![[ ]](/icons/layout.gif) | L3-GIM_Dernier-TD-auto-5-asservissement et régulation.pdf | 2021-04-03 22:07 | 603K | |
![[ ]](/icons/layout.gif) | L1-GPL_Gestion des coûts ch 03.pdf | 2021-04-06 11:16 | 603K | |
![[ ]](/icons/layout.gif) | Gestion des coûts ch 03.pdf | 2021-04-06 11:19 | 603K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD-8_Hydraulique proportionnelle.pdf | 2021-04-03 22:12 | 602K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP N°05 dessin d'ensemble LE PERFORATEUR (1er Année GPL).pdf | 2021-04-03 21:14 | 601K | |
![[ ]](/icons/layout.gif) | Compte-Rendu PPP2.pdf | 2021-04-03 20:55 | 599K | |
![[ ]](/icons/layout.gif) | Compte-Rendu PPP2 (3).pdf | 2021-04-03 20:55 | 599K | |
![[ ]](/icons/layout.gif) | Compte-Rendu PPP2 (2).pdf | 2021-04-03 20:55 | 599K | |
![[ ]](/icons/layout.gif) | Compte-Rendu PPP2 (1).pdf | 2021-04-03 20:54 | 599K | |
![[ ]](/icons/layout.gif) | L1-GIM_TP2 auto 2.pdf | 2021-04-03 21:09 | 596K | |
![[ ]](/icons/layout.gif) | Gestion de la production PARTIE 1.pdf | 2021-04-29 09:53 | 588K | |
![[ ]](/icons/layout.gif) | TD 6 RDM.pdf | 2021-04-04 10:04 | 588K | |
![[ ]](/icons/layout.gif) | TP1 Métallographie PMI GIM 2020.pdf | 2021-04-03 22:20 | 584K | |
![[ ]](/icons/layout.gif) | Maintenance_des_Equipements.pdf | 2021-04-25 11:25 | 583K | |
![[ ]](/icons/unknown.gif) | Electronique 1.rar | 2021-04-21 11:48 | 582K | |
![[ ]](/icons/layout.gif) | TD 5 RDM.pdf | 2021-04-04 10:04 | 581K | |
![[ ]](/icons/layout.gif) | L3-GIM_TP- Opération de maintenance1- part2.pdf | 2021-04-03 22:12 | 577K | |
![[ ]](/icons/layout.gif) | Cours 1 Généralités (metrologie 1)(LTS-S1).pdf | 2020-12-08 10:10 | 575K | |
![[ ]](/icons/layout.gif) | L1-PMI et GIM_TD 4 matériaux 2.pdf | 2021-04-03 21:14 | 574K | |
![[ ]](/icons/layout.gif) | TP1 Métallographie PMI et LTS 2021.pdf | 2021-04-21 12:23 | 573K | |
![[ ]](/icons/layout.gif) | Cours 1 Généralités de la maintenance (Caractérisation et maintenance des moyens)(GPL-S1).pdf | 2020-12-07 10:08 | 571K | |
![[ ]](/icons/layout.gif) | Cour 1 lubrification .pdf | 2020-12-07 19:44 | 570K | |
![[ ]](/icons/layout.gif) | Chapitre 2 Structures et Caractéristiques mécaniques des matériaux 2020.pdf | 2021-01-02 10:24 | 569K | |
![[ ]](/icons/unknown.gif) | CHAPITRE 3 Introduction.docx | 2021-12-05 10:04 | 561K | |
![[ ]](/icons/layout.gif) | L1-GPL_Cours MECA 2 ch4 et ch5 GPL.pdf | 2021-04-03 21:11 | 560K | |
![[ ]](/icons/layout.gif) | WRITING EMAILS AND LETTERS.pdf | 2021-04-04 11:03 | 556K | |
![[ ]](/icons/layout.gif) | L1-PMI_TD3 correction Dess. Indu.2.pdf | 2021-04-03 21:48 | 551K | |
![[ ]](/icons/layout.gif) | L3-GIM_D-Auto-4_Dernier TD.pdf | 2021-04-03 22:06 | 549K | |
![[ ]](/icons/layout.gif) | L1-GIM_Electrotechnique 1-TP.pdf | 2021-04-03 21:08 | 543K | |
![[ ]](/icons/layout.gif) | TD 1 RDM.pdf | 2021-04-03 22:18 | 540K | |
![[ ]](/icons/layout.gif) | L1-GIM_AUTO 2-solution TD4.pdf | 2021-04-03 21:08 | 538K | |
![[ ]](/icons/layout.gif) | Chapitre 1 La fonction sécurité dans l’entreprise.pdf | 2021-04-21 11:57 | 534K | |
![[IMG]](/icons/image2.gif) | CCI21032020_0002.jpg | 2021-04-03 20:54 | 522K | |
![[ ]](/icons/layout.gif) | TD 1, 2, 3 FAB 7.pdf | 2021-04-03 22:19 | 521K | |
![[ ]](/icons/layout.gif) | TD 1, 2, 3 FAB 7 (1).pdf | 2021-04-03 22:18 | 521K | |
![[ ]](/icons/layout.gif) | L2-MPI_TD 1_ 2_ 3 FAB 7.pdf | 2021-04-03 21:49 | 521K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD-auto-5-calcul-Gains-régulateur-PID.pdf | 2021-04-03 22:12 | 521K | |
![[ ]](/icons/layout.gif) | Chapitre 2 Assemblages filetés 2022 S2.pdf | 2022-03-02 13:10 | 518K | |
![[ ]](/icons/layout.gif) | L3-PMI_La comptabilité Générale.pdf | 2021-02-03 10:36 | 516K | |
![[ ]](/icons/layout.gif) | cours1 fab4.pdf | 2020-12-06 21:37 | 515K | |
![[ ]](/icons/layout.gif) | CoursThermodynamique.pdf | 2021-01-26 08:48 | 512K | |
![[ ]](/icons/layout.gif) | TD 2 RDM.pdf | 2021-04-04 10:04 | 511K | |
![[ ]](/icons/layout.gif) | 2ème cours de Qualité PMI L2.pdf | 2021-04-21 12:18 | 508K | |
![[ ]](/icons/layout.gif) | TP2 Traitement thermique2020.pdf | 2021-04-03 22:20 | 507K | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM_Matériaux2-TP2 Traitements thermiques.pdf | 2021-04-03 21:46 | 507K | |
![[ ]](/icons/layout.gif) | Chapitre_1__PREVENTION_DES_ACCIDENTS_DU_TRAVAIL_ET_DES_MALADIES_PROFESSIONNELLES.pdf | 2020-12-10 10:49 | 504K | |
![[ ]](/icons/unknown.gif) | TDs PDF.rar | 2022-03-22 08:16 | 503K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO3-TP 6_Asservissement.pdf | 2021-04-03 22:01 | 499K | |
![[ ]](/icons/layout.gif) | TP2 Traitements thermiques2021.pdf | 2021-05-04 09:05 | 498K | |
![[ ]](/icons/layout.gif) | Cours 2-Electricité 2-représentations vectorielle.pdf | 2020-12-06 20:51 | 495K | |
![[ ]](/icons/layout.gif) | Chapitre 2 Semi_Conducteurs Electronics 2.pdf | 2025-04-08 14:18 | 493K | |
![[ ]](/icons/layout.gif) | L1-GIM_Thermique 1-Convection et rayonnement.pdf | 2021-04-03 21:09 | 490K | |
![[ ]](/icons/layout.gif) | cours 2 Fab4.pdf | 2020-12-14 10:05 | 490K | |
![[ ]](/icons/layout.gif) | Cours de management L2_PMI et L3_GIM .pdf | 2021-04-03 20:57 | 489K | |
![[ ]](/icons/unknown.gif) | MECA 1 Chapitre 3.docx | 2020-12-12 20:38 | 478K | |
![[ ]](/icons/layout.gif) | Cours 5 usure des Outils.pdf | 2021-01-19 09:14 | 476K | |
![[ ]](/icons/layout.gif) | Chapitre 1.pdf | 2020-12-06 21:19 | 475K | |
![[ ]](/icons/layout.gif) | Chapitre2 Systèmes de numération et codage des nombres 2ème séance Jeudi 03_12_20 PMI et TS S1.pdf | 2020-12-03 21:56 | 475K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-TP5_AR.pdf | 2021-04-06 14:38 | 470K | |
![[ ]](/icons/layout.gif) | Ch 3 liaisons mécaniques 2022.pdf | 2022-03-15 09:27 | 469K | |
![[ ]](/icons/layout.gif) | TD 1 MECA 4.pdf | 2021-04-03 22:18 | 468K | |
![[ ]](/icons/layout.gif) | L3-GIM_TP-4_hydralique-proportionnelle.pdf | 2021-04-03 22:13 | 459K | |
![[ ]](/icons/layout.gif) | TD proprietés des materiaux prof.pdf | 2021-01-30 10:34 | 453K | |
![[ ]](/icons/layout.gif) | L1-GIM_TP3 AUTO 2.pdf | 2021-04-03 21:09 | 444K | |
![[ ]](/icons/layout.gif) | L1-GIM_Hydrau et pneum-Solution TD4.pdf | 2021-04-03 21:09 | 443K | |
![[ ]](/icons/layout.gif) | Sécurité 2.pdf | 2020-12-03 21:30 | 443K | |
![[ ]](/icons/layout.gif) | TD qualite 2eme Année GIM.pdf | 2021-04-06 10:16 | 441K | |
![[ ]](/icons/layout.gif) | L2-GPJ_Cours aménagement d'un poste de travail_Chap. 1 et 2.pdf | 2020-12-03 21:06 | 436K | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM-GPL_Anglais2_lexique_mecanique_anglais_francais.pdf | 2021-04-03 21:16 | 434K | |
![[ ]](/icons/layout.gif) | PMI AUTO 3 Chapitres 1&2.pdf | 2021-04-21 11:53 | 433K | |
![[ ]](/icons/compressed.gif) | cour 1, management.zip | 2020-12-01 23:49 | 431K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-TP3_AR.pdf | 2021-04-06 14:37 | 424K | |
![[ ]](/icons/layout.gif) | Chapitre 3 diagramme d'équilibre.pdf | 2021-02-08 08:34 | 423K | |
![[ ]](/icons/unknown.gif) | gestiondes stocks 1.ppt | 2021-02-17 08:41 | 423K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 TD 4 BODE Solution.pdf | 2021-04-03 22:01 | 421K | |
![[ ]](/icons/layout.gif) | Partie 2 GESTION DE PRODUCTION.pdf | 2021-04-29 09:53 | 421K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP n 04 Dessin Idustriel 1.pdf | 2021-04-03 21:14 | 420K | |
![[ ]](/icons/layout.gif) | ORGANISATION ET LOGISTIQUE DE MAINTENANCE cours2.pdf | 2021-05-18 09:59 | 418K | |
![[ ]](/icons/layout.gif) | Sécurité 1.pdf | 2020-12-03 21:26 | 418K | |
![[ ]](/icons/unknown.gif) | GPL 1 COURS STRUCTUR et ORGANISATION DES ENTREPRISES.docx | 2021-01-26 08:37 | 412K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD - GMAO.pdf | 2021-04-03 22:11 | 407K | |
![[IMG]](/icons/image2.gif) | CCI21032020.jpg | 2021-04-03 20:54 | 405K | |
![[ ]](/icons/layout.gif) | DéVELOPPEMENT DURALE TALHI.pdf | 2022-04-17 14:15 | 403K | |
![[ ]](/icons/unknown.gif) | cours d'anglais s2.rar | 2021-04-06 13:48 | 403K | |
![[ ]](/icons/unknown.gif) | English.rar | 2021-01-22 20:36 | 402K | |
![[ ]](/icons/unknown.gif) | L2-GIM_Cablage et Maint. Syst.Electriques-TD_1_2_3_4_CMSE3_S4GIM.rar | 2021-04-03 21:49 | 393K | |
![[ ]](/icons/layout.gif) | L3-GIM_TP2-Auto-5.pdf | 2021-04-03 22:13 | 388K | |
![[ ]](/icons/layout.gif) | L3-GIM_TP1-Auto-5.pdf | 2021-04-03 22:13 | 388K | |
![[ ]](/icons/layout.gif) | L3-GIM_TP3-Auto-5.pdf | 2021-04-06 14:23 | 387K | |
![[ ]](/icons/layout.gif) | TP. Optimisation (TOURNAGE).pdf | 2021-02-08 08:18 | 384K | |
![[ ]](/icons/layout.gif) | L2 PMI-L3 GIM_TD MANAGEMENT.pdf | 2021-04-03 21:49 | 383K | |
![[ ]](/icons/layout.gif) | L2-GIM_Chiffrage de projet.pdf | 2021-02-03 10:36 | 382K | |
![[ ]](/icons/layout.gif) | TD 2 MECA 4.pdf | 2021-04-03 22:19 | 379K | |
![[ ]](/icons/layout.gif) | TD N 05 Dess- Ind- 1er Année GPL .pdf | 2021-04-03 22:20 | 378K | |
![[ ]](/icons/layout.gif) | TD N 05 Dess- Ind- 1er Année GPL (1).pdf | 2021-04-03 22:20 | 378K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD N 05 Dess- Ind- 1er Année GPL .pdf | 2021-04-03 21:13 | 378K | |
![[ ]](/icons/layout.gif) | MECA 1 (Chapitre 2).pdf | 2020-12-09 10:29 | 373K | |
![[ ]](/icons/layout.gif) | Cours 6 Efforts et puissance de coupe.pdf | 2021-01-19 09:14 | 373K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-TP4_AR.pdf | 2021-04-06 14:37 | 371K | |
![[ ]](/icons/layout.gif) | TD 4 RDM.pdf | 2021-04-03 22:18 | 370K | |
![[ ]](/icons/layout.gif) | L2-PMI_TP 4 FAB8.pdf | 2021-04-03 22:02 | 369K | |
![[ ]](/icons/layout.gif) | Electronics 1 _Chapitre 1 Quadripole .pdf | 2025-02-23 07:10 | 369K | |
![[ ]](/icons/unknown.gif) | CHAPITRE IV GPL2 .docx | 2021-04-04 11:03 | 368K | |
![[ ]](/icons/unknown.gif) | TDs Hydrauli et pnematique 1 GIM.rar | 2022-03-30 10:37 | 367K | |
![[ ]](/icons/unknown.gif) | TDs.rar | 2021-12-05 10:55 | 367K | |
![[ ]](/icons/unknown.gif) | CHAPITRE III.docx | 2021-12-05 10:04 | 366K | |
![[ ]](/icons/layout.gif) | Chapitre 1 (2) matériaux S1 GIM PMI Soudage.pdf | 2020-12-06 21:06 | 364K | |
![[ ]](/icons/layout.gif) | cours roulements a contact oblique.pdf | 2021-02-28 10:13 | 363K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD Diagramme de GANTT.pdf | 2021-04-06 11:17 | 360K | |
![[ ]](/icons/unknown.gif) | systeme hydrauliqe .docx | 2020-12-06 10:57 | 358K | |
![[ ]](/icons/layout.gif) | Cours 4.pdf | 2021-01-06 22:32 | 356K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD N°03 MECA 2.pdf | 2021-04-03 21:13 | 354K | |
![[ ]](/icons/layout.gif) | Chapitre1 Généralités sur le dessin industriel(1).pdf | 2020-12-07 11:54 | 353K | |
![[ ]](/icons/layout.gif) | TP3 matériaux 1 2020.pdf | 2021-01-23 21:27 | 347K | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM-GPL_Chapitre_intégrales.pdf | 2021-04-03 21:16 | 346K | |
![[IMG]](/icons/image2.gif) | CCI21032020_0003.jpg | 2021-04-03 20:54 | 344K | |
![[ ]](/icons/layout.gif) | L1-PMI_TP3 dessin industrièl.pdf | 2021-04-03 21:49 | 344K | |
![[ ]](/icons/layout.gif) | L1-GPL_Gestion des coûts ch 02.pdf | 2021-04-03 21:13 | 343K | |
![[ ]](/icons/layout.gif) | Gestion des coûts ch 02.pdf | 2021-04-03 21:08 | 343K | |
![[ ]](/icons/layout.gif) | Gestion des coûts ch 02 (1).pdf | 2021-04-03 21:08 | 343K | |
![[ ]](/icons/compressed.gif) | archive(8).zip | 2021-02-10 10:46 | 342K | |
![[ ]](/icons/layout.gif) | Exercices_Electricité 2.pdf | 2021-03-09 10:06 | 334K | |
![[ ]](/icons/layout.gif) | L1-PMI_TP 5 Dessin industriel 2.pdf | 2021-04-03 21:48 | 333K | |
![[ ]](/icons/layout.gif) | L1-GPL_Gestion des Coûts-Chapitre 04.pdf | 2021-04-03 21:13 | 332K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO3-TP 4_Asservissement.pdf | 2021-04-03 22:01 | 327K | |
![[ ]](/icons/layout.gif) | Cours Métrologie N02 (pour 1ére année PMI).pdf | 2020-12-08 08:29 | 315K | |
![[ ]](/icons/layout.gif) | L1-GIM_AUTO 2-TD4.pdf | 2021-04-03 21:08 | 312K | |
![[ ]](/icons/layout.gif) | L2-PMI et L3-GIM_ Management-SOLUTION TD.pdf | 2021-04-03 22:00 | 306K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 TD 3 Solution1.pdf | 2021-04-03 22:01 | 305K | |
![[ ]](/icons/layout.gif) | TD 2 Méca2, 1er Année GPL..pdf | 2021-04-03 22:19 | 302K | |
![[ ]](/icons/layout.gif) | TD 2 Méca2, 1er Année GPL. (1).pdf | 2021-04-03 22:19 | 302K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD 2 Méca2, 1er Année GPL..pdf | 2021-04-03 21:13 | 302K | |
![[ ]](/icons/layout.gif) | technique d'élaboration des avant projet.pdf | 2020-12-03 21:45 | 296K | |
![[ ]](/icons/layout.gif) | TD 3 RDM.pdf | 2021-04-03 22:19 | 294K | |
![[ ]](/icons/layout.gif) | Chapitre II gestion stock.pdf | 2021-05-18 09:52 | 293K | |
![[ ]](/icons/layout.gif) | L2-GIM_Cours N° 1 et 2_Conduite de projet.pdf | 2020-12-03 21:03 | 293K | |
![[ ]](/icons/layout.gif) | Outils de contrôle cours4.pdf | 2021-05-16 10:27 | 291K | |
![[ ]](/icons/layout.gif) | L2 GPL et L3 PMI_Test Cours numéro 01 La qualité - Copie.pdf | 2021-01-16 15:44 | 291K | |
![[ ]](/icons/unknown.gif) | Maintenance_des_Equipements cours1.docx | 2021-10-27 13:05 | 290K | |
![[ ]](/icons/layout.gif) | TD soudage sous flux solide 1.pdf | 2022-04-18 12:52 | 290K | |
![[ ]](/icons/layout.gif) | L1-GPL_Corrigé de TDN° 02-Géstion des Couts.pdf | 2021-04-03 21:10 | 288K | |
![[ ]](/icons/layout.gif) | PMI ORGANISATION part1.pdf | 2021-04-29 10:08 | 284K | |
![[ ]](/icons/layout.gif) | Gestion de la maintenance - GM-ch1- Merredi 02-12-2020.pdf | 2020-12-02 00:28 | 284K | |
![[ ]](/icons/layout.gif) | Chapitre1 Classes des materiaux _1_.pdf | 2020-12-06 11:06 | 282K | |
![[ ]](/icons/layout.gif) | Chapitre 2 _AOP Electronics 1.pdf | 2025-04-08 14:17 | 279K | |
![[ ]](/icons/layout.gif) | L1-GIM_Hydrauli et pneum-Solution TD3.pdf | 2021-04-03 21:09 | 278K | |
![[ ]](/icons/layout.gif) | chapitre44.pdf | 2021-05-18 10:09 | 278K | |
![[ ]](/icons/unknown.gif) | L1-PMI_FAB2-TD 4.rar | 2021-04-03 21:48 | 276K | |
![[ ]](/icons/layout.gif) | Conduite de Projet_étude de cas_L2-PMI et L1-GPL.pdf | 2021-04-03 20:55 | 267K | |
![[ ]](/icons/layout.gif) | L1-PMI et GIM_Chapitre 4 matériaux 2.pdf | 2021-04-03 21:14 | 266K | |
![[ ]](/icons/layout.gif) | L1-PMI et GPL_TD Fab 3 Tableaux.pdf | 2021-04-03 21:15 | 264K | |
![[ ]](/icons/unknown.gif) | L2-PMI et GIM_Com4-La sémiologie.pptx | 2021-04-03 21:50 | 259K | |
![[ ]](/icons/layout.gif) | Contrôle de la conformité_1er_GPL_S2.pdf.pdf | 2024-12-01 12:16 | 256K | |
![[ ]](/icons/layout.gif) | L2-GIM_ MécaFluides-Exercice (Dynamique des fluides réels)_2.pdf | 2021-04-03 21:49 | 254K | |
![[ ]](/icons/layout.gif) | L3-PMI_Cours de Législation.pdf | 2021-04-03 22:13 | 251K | |
![[ ]](/icons/layout.gif) | PMI ORGANISATION part2.pdf | 2021-04-29 10:08 | 251K | |
![[ ]](/icons/layout.gif) | cours de COMPTABILITE 1ère année GPL S1 2021.pdf | 2021-01-16 15:27 | 250K | |
![[ ]](/icons/layout.gif) | L3-GIM_GMAO-TD - 5-6-7-8.pdf | 2021-04-03 22:07 | 250K | |
![[ ]](/icons/layout.gif) | chapitre3.pdf | 2021-05-04 11:44 | 247K | |
![[ ]](/icons/layout.gif) | Ch 2 Dessin d'ensemble 2022.pdf | 2022-03-15 09:27 | 244K | |
![[ ]](/icons/layout.gif) | TD Sécurité 2.pdf | 2021-04-03 22:20 | 242K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP N° 2 Conception mécanique.pdf | 2021-04-03 21:14 | 242K | |
![[ ]](/icons/layout.gif) | PLANIFICATION_et_Ordonnancement-2.pdf | 2022-04-20 12:03 | 241K | |
![[ ]](/icons/layout.gif) | L1-PMI_TP4 Dess- Ind- 2.pdf | 2021-04-03 21:49 | 240K | |
![[ ]](/icons/layout.gif) | Chapitre 3 Assemblages par collage 2022 S2.pdf | 2022-03-02 13:10 | 238K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD N 4 MECA 2 1ER Année GPL.pdf | 2021-04-03 21:13 | 237K | |
![[ ]](/icons/layout.gif) | L3-GIM_ Coût de la maintenance-TD N° 04.pdf | 2021-04-03 22:06 | 236K | |
![[ ]](/icons/layout.gif) | TD soudage sous flux solide 2.pdf | 2022-04-18 12:52 | 235K | |
![[ ]](/icons/layout.gif) | L1-PMI_TD4 Dessin idus 2.pdf | 2021-04-03 21:48 | 234K | |
![[ ]](/icons/layout.gif) | L1-GPL_Méca 2-TD N° 06 + Corrigé.pdf | 2021-04-03 21:13 | 230K | |
![[ ]](/icons/layout.gif) | L1-PMI et GIM_Matériaux 2-Devoir N°2.pdf | 2021-04-03 21:14 | 229K | |
![[ ]](/icons/layout.gif) | TD1 L1_GIM.pdf | 2021-04-03 22:20 | 226K | |
![[ ]](/icons/layout.gif) | L3-GIM-Réseau Automate_TD1_AR.pdf | 2021-04-03 22:06 | 225K | |
![[ ]](/icons/layout.gif) | chapitre 2.pdf | 2021-05-16 10:19 | 224K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 TD 5 Nyquist.pdf | 2021-04-03 22:01 | 221K | |
![[ ]](/icons/layout.gif) | Electronics 2_Chapter 1 Transient behavior of first-order circuits.pdf | 2025-02-23 07:10 | 218K | |
![[ ]](/icons/layout.gif) | cours maintenance.pdf | 2021-02-28 10:50 | 217K | |
![[ ]](/icons/layout.gif) | L1-GIM_Hydraulique et Pneumatique-TD 3-4.pdf | 2021-04-03 21:09 | 215K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO3-TP 5_Asservissement.pdf | 2021-04-03 22:01 | 212K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD N° 04 coût de maintenace.pdf | 2021-04-03 22:11 | 210K | |
![[ ]](/icons/layout.gif) | L1-GPL_Méca 2-TD N° 05+Corrigé.pdf | 2021-04-03 21:13 | 203K | |
![[ ]](/icons/layout.gif) | L1-PMI et GIM_Devoir N°1 matériaux 2 PMI et GIM L1.pdf | 2021-04-03 21:14 | 200K | |
![[ ]](/icons/unknown.gif) | maintenance omm1 s1.docx | 2021-11-11 09:43 | 198K | |
![[ ]](/icons/layout.gif) | TD de l'Organisation de l'entreprise.pdf | 2021-04-21 12:02 | 197K | |
![[ ]](/icons/layout.gif) | L3-GIM_Job Interview Questions.pdf | 2021-04-03 22:07 | 197K | |
![[ ]](/icons/layout.gif) | L2 GPL_Cours GPAO.pdf | 2021-04-04 11:07 | 186K | |
![[ ]](/icons/layout.gif) | Cours 4, management.pdf | 2020-12-12 20:34 | 185K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseaux automates_TD1_AR.pdf | 2021-04-03 22:09 | 184K | |
![[ ]](/icons/layout.gif) | structure et organisation S1 GPL .pdf | 2020-12-08 10:19 | 176K | |
![[ ]](/icons/compressed.gif) | COM(5.zip | 2021-04-03 20:54 | 176K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseau automates-TP1_AR.pdf | 2021-04-06 14:41 | 174K | |
![[ ]](/icons/layout.gif) | L3-GIM-Réseau Automate_TP1_AR.pdf | 2021-04-03 22:06 | 174K | |
![[ ]](/icons/layout.gif) | L1-PMI-GIM_TD 3 matériaux 2 correction.pdf | 2021-04-03 21:46 | 170K | |
![[ ]](/icons/layout.gif) | L1-GPL_TP 3-Informatique 1.pdf | 2021-04-03 21:14 | 169K | |
![[ ]](/icons/layout.gif) | L1-GPL_Gestion des coûts-TD N° 04 +Corrigé.pdf | 2021-04-03 21:13 | 168K | |
![[ ]](/icons/layout.gif) | TD de la Partie I.pdf | 2021-04-03 22:19 | 161K | |
![[ ]](/icons/layout.gif) | Etudes des défaillances COURS 1.pdf | 2021-05-05 10:14 | 159K | |
![[ ]](/icons/layout.gif) | Chapitre 1 Procédés d'assemblage 2022 S2.pdf | 2022-03-02 13:10 | 156K | |
![[ ]](/icons/unknown.gif) | L1-GIM_Devoir Elect. 1et 2.rar | 2021-04-03 21:08 | 156K | |
![[ ]](/icons/unknown.gif) | L1-GIM_Devoir Elect. 1et 2 (1).rar | 2021-04-03 21:08 | 156K | |
![[ ]](/icons/layout.gif) | consignes_redaction_rapports_stage.pdf | 2021-03-09 10:05 | 156K | |
![[ ]](/icons/layout.gif) | L3-GIM_Tenses.pdf | 2021-04-03 22:12 | 147K | |
![[ ]](/icons/layout.gif) | L2-PMI et GIM_Maths 4- Série de fourrier.pdf | 2021-04-03 21:50 | 145K | |
![[ ]](/icons/layout.gif) | TD MOTEUR L1_GIM.pdf | 2021-04-03 22:20 | 145K | |
![[ ]](/icons/layout.gif) | TD N° 2 Gestion des coûts .pdf | 2021-04-06 11:19 | 144K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD N° 2 Gestion des coûts .pdf | 2021-04-06 11:16 | 144K | |
![[ ]](/icons/layout.gif) | L1-PMI et GPL_TP Fab 3 + Dessin de définition.pdf | 2021-04-03 21:15 | 143K | |
![[ ]](/icons/layout.gif) | corrige_td_stock.pdf | 2021-02-17 08:34 | 141K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseaux automates_TD3_AR.pdf | 2021-04-03 22:09 | 141K | |
![[ ]](/icons/unknown.gif) | TD 3et 4 verin accumula GPL2 .docx | 2021-04-04 11:03 | 137K | |
![[ ]](/icons/layout.gif) | Structure et Environnement de l'entreprise (10).pdf | 2021-01-05 19:06 | 136K | |
![[ ]](/icons/layout.gif) | TD 01.pdf | 2022-03-02 13:31 | 136K | |
![[ ]](/icons/layout.gif) | Ch 1Cahier des charges 2022.pdf | 2022-03-15 09:26 | 128K | |
![[ ]](/icons/unknown.gif) | TP 01 OMM_GIM 1.docx | 2021-04-21 11:45 | 124K | |
![[ ]](/icons/layout.gif) | Auto 2 cours 2 (1).pdf | 2020-12-08 10:19 | 124K | |
![[ ]](/icons/layout.gif) | systeme hydraulique cours 2.pdf | 2020-12-08 10:16 | 124K | |
![[ ]](/icons/layout.gif) | communication S1 lesson 1-converti.pdf | 2021-01-16 15:59 | 124K | |
![[ ]](/icons/layout.gif) | Auto 2 cours 2 .pdf | 2020-12-07 19:39 | 124K | |
![[ ]](/icons/unknown.gif) | _Cours_Maintenance OMM1.docx | 2021-02-28 12:55 | 122K | |
![[ ]](/icons/layout.gif) | L3-GIM_TD n°5_Meca 7_L3_GIM.pdf | 2021-04-03 22:11 | 121K | |
![[ ]](/icons/layout.gif) | TD n°5meca7.pdf | 2022-01-18 07:41 | 121K | |
![[ ]](/icons/layout.gif) | TD n°5.pdf | 2021-05-31 10:24 | 121K | |
![[ ]](/icons/layout.gif) | Approche économique et comptable d'une entreprise chapitre I.pdf | 2020-12-07 19:50 | 119K | |
![[ ]](/icons/unknown.gif) | Fiabilité1.docx | 2021-02-14 10:00 | 116K | |
![[ ]](/icons/layout.gif) | L3-GIM_Réseaux automates_TD2_AR.pdf | 2021-04-03 22:09 | 112K | |
![[ ]](/icons/unknown.gif) | fascicule_hygiene_securite cours1.docx | 2021-10-27 13:09 | 105K | |
![[ ]](/icons/unknown.gif) | Maintenance_des_Equipements cours 2.docx | 2021-10-27 13:05 | 103K | |
![[ ]](/icons/unknown.gif) | English3.rar | 2021-01-22 20:51 | 101K | |
![[ ]](/icons/layout.gif) | L3-GIM_English Vocabulary.pdf | 2021-04-03 22:07 | 101K | |
![[ ]](/icons/unknown.gif) | rapport de stage d'observation.docx | 2021-02-20 20:50 | 99K | |
![[ ]](/icons/layout.gif) | L1-PMI_TD de soudage.pdf | 2021-04-03 21:48 | 99K | |
![[ ]](/icons/unknown.gif) | PowerPoint niveau et operation.pptx | 2021-02-28 10:50 | 93K | |
![[ ]](/icons/unknown.gif) | tps.rar | 2021-06-13 09:31 | 84K | |
![[ ]](/icons/unknown.gif) | TP2_gestion_projet021.doc | 2021-06-13 09:28 | 84K | |
![[ ]](/icons/layout.gif) | Cours_Gestion stock.pdf | 2020-12-08 11:06 | 79K | |
![[ ]](/icons/unknown.gif) | L3-GIM_Com5- communication dans l'entreprise.pptx | 2021-04-03 22:06 | 71K | |
![[ ]](/icons/unknown.gif) | L3-GIM_Com5_ 2éme partie - communication dans l'entreprise.pptx | 2021-04-03 22:06 | 70K | |
![[ ]](/icons/layout.gif) | L1-GPL_TD N° 03 Gestion des couts.pdf | 2021-04-03 21:13 | 68K | |
![[ ]](/icons/layout.gif) | L1-PMI_AUTO 3 TD 7 Correcteurs Enoncé.pdf | 2021-04-03 21:46 | 68K | |
![[ ]](/icons/unknown.gif) | PowerPoint les niveaux et TPM.pptx | 2021-02-28 10:50 | 65K | |
![[ ]](/icons/unknown.gif) | TP ou TD MAINTENANCE.docx | 2021-02-28 12:55 | 60K | |
![[ ]](/icons/layout.gif) | Stock.pdf | 2020-12-08 11:05 | 57K | |
![[ ]](/icons/unknown.gif) | cours omm.docx | 2021-02-28 10:50 | 55K | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Anglais2_List of Irregular Verbs.docx | 2021-04-03 21:16 | 52K | |
![[ ]](/icons/layout.gif) | L2-PMI_Devoir 01 AUTO3.pdf | 2021-04-03 22:01 | 52K | |
![[ ]](/icons/unknown.gif) | Chapitre II gestion stock.docx | 2021-05-18 09:34 | 46K | |
![[ ]](/icons/unknown.gif) | TP1_gestion_projet_ISTA.docx | 2021-06-13 09:28 | 35K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 TD 4 BODE Ennoncé.pdf | 2021-04-03 22:01 | 28K | |
![[ ]](/icons/unknown.gif) | TP conduite de projet.docx | 2021-06-13 09:28 | 26K | |
![[ ]](/icons/unknown.gif) | L2-PMI_Math 4 TP.rar | 2021-04-03 22:01 | 25K | |
![[ ]](/icons/unknown.gif) | Ecrits professionnels.docx | 2021-06-06 11:00 | 22K | |
![[ ]](/icons/layout.gif) | L2-PMI_AUTO 3 TD 5 Nyquist Ennoncé.pdf | 2021-04-03 22:01 | 22K | |
![[ ]](/icons/unknown.gif) | Rédaction du rapport. RAPPORT TECHNIQUE.docx | 2021-06-06 11:00 | 19K | |
![[ ]](/icons/layout.gif) | Cours numéro 01 La qualité.pdf | 2020-12-14 08:51 | 16K | |
![[ ]](/icons/unknown.gif) | Comportement des matériels.docx | 2021-02-28 13:37 | 13K | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Anglais2_WORK VOCABULARY.docx | 2021-04-03 21:16 | 13K | |
![[ ]](/icons/unknown.gif) | L1-PMI-GIM-GPL_Anglais2_WORK VOCABULARY (1).docx | 2021-04-03 21:16 | 13K | |
![[ ]](/icons/layout.gif) | Cours 1-ELP-S3-LES COMPOSANTS D'ELECTRONIQUE DE PUISSANCE.pdf | 2020-12-06 20:47 | 0 | |
![[DIR]](/icons/folder.gif) | management 3 GIM/ | 2022-03-23 10:25 | - | |
![[DIR]](/icons/folder.gif) | economie/ | 2023-05-18 13:57 | - | |
![[DIR]](/icons/folder.gif) | TD/ | 2021-12-05 10:04 | - | |
![[DIR]](/icons/folder.gif) | 2024/ | 2023-11-20 08:19 | - | |
|