![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Épigénétique (Licence 3 Génétique) (Dr REZGOUN Mohamed Larbi).pdf | 2020-11-18 15:41 | 2.1M | |
![[ ]](/icons/layout.gif) | 01. Emploi du temps M2 Génétique.pdf | 2020-12-21 10:40 | 367K | |
![[ ]](/icons/layout.gif) | 03. Emploi du temps M2 BCPI.pdf | 2020-12-21 10:40 | 369K | |
![[ ]](/icons/layout.gif) | 04. Emploi du temps M2 Immunologie MC.pdf | 2020-12-21 10:40 | 437K | |
![[ ]](/icons/layout.gif) | 1-Cours sécurité alimentaire et Toxicologie Chapitre 1 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:29 | 869K | |
![[ ]](/icons/layout.gif) | 1-SOMMAIRE Endocrinologie et régulation des systèmes.pdf | 2020-12-15 12:29 | 63K | |
![[ ]](/icons/layout.gif) | 1 La spectrophotométrie.pdf | 2020-12-06 11:44 | 477K | |
![[ ]](/icons/layout.gif) | 1 introduction.pdf | 2020-12-06 11:44 | 385K | |
![[ ]](/icons/layout.gif) | 1 la spermatogenèse cours .pdf | 2020-12-06 11:43 | 907K | |
![[ ]](/icons/layout.gif) | 2-Cours Endocrinologie et régulation des systèmes Chapitre 1 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 1.3M | |
![[ ]](/icons/layout.gif) | 2cartographie physique.pdf | 2020-12-06 11:44 | 1.6M | |
![[ ]](/icons/layout.gif) | 2 chromatographie.pdf | 2020-12-06 11:44 | 462K | |
![[ ]](/icons/layout.gif) | 2ovogénèse cours .pdf | 2020-12-06 11:43 | 932K | |
![[ ]](/icons/layout.gif) | 3-Cours Endocrinologie et régulation des systèmes Chapitre 2 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 1.3M | |
![[ ]](/icons/layout.gif) | 3 La fécondation cours.pdf | 2020-12-06 11:43 | 665K | |
![[ ]](/icons/layout.gif) | 3Techniques éléctrophorétiques.pdf | 2020-12-06 11:44 | 936K | |
![[ ]](/icons/layout.gif) | 3 cartographie génétique.pdf | 2020-12-06 11:44 | 1.1M | |
![[ ]](/icons/layout.gif) | 4-Cours Endocrinologie et régulation des systèmes Chapitre 3 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 643K | |
![[ ]](/icons/layout.gif) | 4Techniques de séparation.pdf | 2020-12-06 11:44 | 553K | |
![[ ]](/icons/layout.gif) | 5-Cours Endocrinologie et régulation des systèmes Chapitre 4 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 908K | |
![[ ]](/icons/layout.gif) | 5 La microscopie.pdf | 2020-12-06 11:44 | 968K | |
![[ ]](/icons/layout.gif) | 6-Cours Endocrinologie et régulation des systèmes Chapitre 5 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 1.5M | |
![[ ]](/icons/layout.gif) | 7-Cours Endocrinologie et régulation des systèmes Chapitre 6 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 614K | |
![[ ]](/icons/layout.gif) | 8-Cours Endocrinologie et régulation des systèmes Chapitre 7 M1 TOXICOLOGIE 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 1.4M | |
![[ ]](/icons/layout.gif) | Bioclimatologie.pdf | 2020-12-11 23:44 | 7.0M | |
![[ ]](/icons/layout.gif) | Biologie fondamentale.pdf | 2020-12-11 23:43 | 275K | |
![[ ]](/icons/layout.gif) | Botanique.pdf | 2021-01-11 11:40 | 813K | |
![[ ]](/icons/layout.gif) | COMMUNICATION.pdf | 2020-12-11 23:43 | 892K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS L3 TOXICOLOGIE - Lesson 01. Common and Proper Nouns.pdf | 2020-12-15 09:27 | 126K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS L3 TOXICOLOGIE - Lesson 02. The Plural.pdf | 2020-12-15 09:27 | 161K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS L3 TOXICOLOGIE - Lesson 03. Pronouns.pdf | 2020-12-15 09:27 | 543K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS L3 TOXICOLOGIE - Lesson 04. Adjectives.pdf | 2020-12-15 09:26 | 334K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS M1TOXICOLOGIE - Lesson 01. The Present Simple.pdf | 2020-12-15 12:28 | 632K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS M1 TOXICOLOGIE - Lesson 02. Common and Proper Nouns.pdf | 2020-12-15 12:28 | 126K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS M1 TOXICOLOGIE - Lesson 03. The Plural.pdf | 2020-12-15 12:28 | 161K | |
![[ ]](/icons/layout.gif) | COURS ANGLAIS M1TOXICOLOGIE - Lesson 04. Prepositions.pdf | 2020-12-15 12:28 | 549K | |
![[ ]](/icons/layout.gif) | COURS BIOINFORMATIQUE S1 M1 TOXICOLOGIE 2020-2021 BOULKANDOUL.pdf | 2020-12-15 12:29 | 1.2M | |
![[ ]](/icons/unknown.gif) | COURS COMPLET CYTO M2.docx | 2020-12-08 15:50 | 7.9M | |
![[ ]](/icons/layout.gif) | COURS GENOTOXIC 2021-converti.pdf | 2020-12-08 15:51 | 2.5M | |
![[ ]](/icons/layout.gif) | COURS PHARMACOLOGIE CHAPITRE 1 L3 TOXICOLOGIE 2020-2021 DEHILI.pdf | 2020-12-15 09:27 | 822K | |
![[ ]](/icons/layout.gif) | COURS PHARMACOLOGIE CHAPITRE 2 L3 TOXICOLOGIE 2020-2021 DEHILI.pdf | 2020-12-15 09:27 | 191K | |
![[ ]](/icons/layout.gif) | COURS PHARMACOLOGIE CHAPITRE 3 L3 TOXICOLOGIE 2020-2021.pdf | 2020-12-15 09:27 | 426K | |
![[ ]](/icons/layout.gif) | COURS PHARMACOLOGIE CHAPITRE 4 L3 TOXICOLOGIE 2020-2021 DEHILI.pdf | 2020-12-15 09:27 | 287K | |
![[ ]](/icons/layout.gif) | COURS PHARMACOLOGIE SOMMAIRE 2020-2021 (DEHILI).pdf | 2020-12-15 09:27 | 90K | |
![[ ]](/icons/layout.gif) | COURS TOXICOLOGIE FONDAMENTALE L3 TOXICOLOGIE (2020-2021) LALAOUI.pdf | 2020-12-15 09:27 | 4.0M | |
![[ ]](/icons/layout.gif) | COURS VIROLOGIE M1.pdf | 2020-12-06 12:46 | 4.1M | |
![[ ]](/icons/unknown.gif) | Canevas des offres de formation L3 IMMUNOLOGIE (à renseigner).docx | 2020-09-01 12:40 | 27K | |
![[ ]](/icons/unknown.gif) | Canevas des offres de formation Licence Toxicologie.docx | 2020-09-01 12:40 | 38K | |
![[ ]](/icons/unknown.gif) | Canevas des offres de formation Master IMMUNOLOGIE MOLECULAIRE ET CELLULAIRE(à renseigner)(2).docx | 2020-09-01 12:39 | 27K | |
![[ ]](/icons/unknown.gif) | Canevas des offres de formation_L3_Entomologie(2).docx | 2020-09-01 12:39 | 22K | |
![[ ]](/icons/unknown.gif) | Canevas des offres de formation_Master_BCPI.docx | 2020-09-01 12:38 | 24K | |
![[ ]](/icons/layout.gif) | Chapitre 5 la recombinaison génétique.pdf | 2020-11-30 10:25 | 414K | |
![[VID]](/icons/movie.gif) | Chapitre I - Définition de l'épigénétique.mp4 | 2021-01-27 10:44 | 78M | |
![[ ]](/icons/layout.gif) | Chapitre I Gestion des hausses.pdf | 2020-12-15 09:26 | 1.3M | |
![[ ]](/icons/layout.gif) | Chapitre II Récolte du miel.pdf | 2021-02-08 13:07 | 1.5M | |
![[ ]](/icons/unknown.gif) | Communication cellulaire par adhérence.pptx | 2020-12-04 10:37 | 3.8M | |
![[ ]](/icons/layout.gif) | Coure Toxicologie des medicaments M2 TOXICOLOGIE 2020-2021 LALAOUI.pdf | 2020-12-15 12:48 | 7.0M | |
![[ ]](/icons/layout.gif) | Cours Anatomie externe L3 Entomologie.pdf | 2020-12-10 08:31 | 9.2M | |
![[ ]](/icons/layout.gif) | Cours Biologie du développement L3 Entomologie.pdf | 2020-12-10 08:37 | 3.3M | |
![[ ]](/icons/layout.gif) | Cours Biostatistiques Chapitre1 M2Toxicologie 2020-2021.pdf | 2020-12-15 12:48 | 1.3M | |
![[ ]](/icons/layout.gif) | Cours COMMUNICATION.pdf | 2020-12-10 09:38 | 892K | |
![[ ]](/icons/layout.gif) | Cours COMMUNICATION M1 TOXICOLOGIE 2020-2021 MOURI.pdf | 2020-12-15 12:28 | 892K | |
![[ ]](/icons/layout.gif) | Cours Entrepreneuriat M2 TOXICOLOGIE 2020-2021 MOURI.pdf | 2020-12-15 12:48 | 713K | |
![[ ]](/icons/layout.gif) | CoursEpidémiologie_M1.pdf | 2020-12-04 13:15 | 198K | |
![[ ]](/icons/layout.gif) | Cours Génomique_M1.pdf | 2020-12-04 13:15 | 330K | |
![[ ]](/icons/layout.gif) | Cours L3 milieu intérieur 2020 2021.pdf | 2020-12-04 12:06 | 742K | |
![[ ]](/icons/layout.gif) | Cours Pesticide Chapitre 1 L3 Entomologie.pdf | 2020-12-10 08:37 | 145K | |
![[ ]](/icons/layout.gif) | Cours controle de qualité M2 Toxicologie 2020-2021 Dr AMRANI.pdf | 2020-12-15 12:49 | 2.8M | |
![[ ]](/icons/layout.gif) | Cours cosmetologie M1 Toxicologie 2020-2021 AMRANI.pdf | 2020-12-15 12:29 | 931K | |
![[ ]](/icons/layout.gif) | Cours d'analyse d'article M2 Toxicologie 2020-2020 BENREBAI.pdf | 2020-12-15 12:48 | 214K | |
![[ ]](/icons/layout.gif) | Cours entrepreneuriat .pdf | 2020-12-10 09:38 | 713K | |
![[ ]](/icons/layout.gif) | Cours organotoxicité et cancer محاضرة 1 M2 Toxicologie 2020-2021 ZAMA.pdf | 2020-12-15 12:48 | 181K | |
![[ ]](/icons/layout.gif) | Cours organotoxicité et cancer محاضرة 2M2 Toxicologie 2020-2021 ZAMA.pdf | 2020-12-15 12:48 | 156K | |
![[ ]](/icons/layout.gif) | Cours sécurité alimentaire et toxicologie Chapitre 2 M2 Toxicologie 2020-2021 BOUBEKRI.pdf | 2020-12-15 12:28 | 1.0M | |
![[ ]](/icons/layout.gif) | Cytogénétique (Master 1 PCPP) (Dr REZGOUN Mohamed Larbi).pdf | 2020-11-18 15:40 | 3.4M | |
![[ ]](/icons/layout.gif) | EMPLOI DU TEMPS MASTER 2 TOXICOLOGIE (1ère ETAPE).pdf | 2020-12-21 10:40 | 108K | |
![[ ]](/icons/layout.gif) | Entomologie Agricole.pdf | 2020-12-11 23:44 | 1.8M | |
![[ ]](/icons/layout.gif) | Entrepreneuriat.pdf | 2020-12-11 23:43 | 713K | |
![[ ]](/icons/layout.gif) | FEUILLE DE ROUTE TOXICOLOGIE FONDAMENTALE.pdf | 2020-12-15 09:27 | 78K | |
![[ ]](/icons/layout.gif) | Feuille de route Sécurité alimentaire M1 Toxicologie BOUBEKRI.pdf | 2020-12-15 12:28 | 152K | |
![[ ]](/icons/layout.gif) | Feuille de route de la matière de cosmetologie et santé publique M1.pdf | 2020-12-15 12:29 | 208K | |
![[ ]](/icons/layout.gif) | Feuille de route endocrinologie M1 TOXICOLOGIE BOUBEKRI.pdf | 2020-12-15 12:28 | 134K | |
![[ ]](/icons/layout.gif) | Feuille de route matière Toxicologie des Medicaments.pdf | 2020-12-15 12:48 | 65K | |
![[ ]](/icons/layout.gif) | Généralités.pdf | 2020-12-15 09:26 | 554K | |
![[ ]](/icons/layout.gif) | Globale Immunologie p1.pdf | 2020-10-27 17:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Globale Immunologie p2.pdf | 2020-10-27 17:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Histologie moléculaire_M1.pdf | 2020-12-04 13:15 | 1.9M | |
![[ ]](/icons/layout.gif) | IMMUNOTHERAPIE M2.pdf | 2020-12-04 13:15 | 259K | |
![[ ]](/icons/layout.gif) | Informatique L3 Entomologie.pdf | 2020-12-10 08:37 | 100K | |
![[ ]](/icons/layout.gif) | Le transport membranaire.pdf | 2020-12-04 10:37 | 1.4M | |
![[ ]](/icons/layout.gif) | Methodologie expérimentale_M2.pdf | 2020-12-04 13:15 | 916K | |
![[ ]](/icons/layout.gif) | Module BMGG Chapitre enzymes de restriction L3 génétique.pdf | 2020-12-15 12:57 | 250K | |
![[ ]](/icons/layout.gif) | Oncogenèse et développement tumoral (Master 2 Génétique) (Dr REZGOUN Mohamed Larbi).pdf | 2020-11-18 15:40 | 2.3M | |
![[ ]](/icons/layout.gif) | PHARMACOLOGIE M1.pdf | 2020-12-04 13:15 | 217K | |
![[ ]](/icons/layout.gif) | PV global session Rattrapage p1.pdf | 2020-11-19 20:29 | 1.6M | |
![[ ]](/icons/layout.gif) | PV global session Rattrapage p2.pdf | 2020-11-19 20:29 | 1.1M | |
![[ ]](/icons/layout.gif) | Physiologie endocrinienne MII.pdf | 2020-12-04 13:15 | 544K | |
![[ ]](/icons/layout.gif) | Physiologie et comportement.pdf | 2020-12-11 23:44 | 451K | |
![[ ]](/icons/layout.gif) | Planning des contrôles (Licences L3) (Session Normale) (S2-2019-2020) (1).pdf | 2020-09-22 22:12 | 438K | |
![[ ]](/icons/layout.gif) | Planning des contrôles (Licences L3) (Session Normale) (S2-2019-2020).pdf | 2020-09-25 13:15 | 438K | |
![[ ]](/icons/layout.gif) | Planning des contrôles (Licences L3) Biologie Animale.pdf | 2020-09-16 23:10 | 439K | |
![[ ]](/icons/layout.gif) | Planning des contrôles (Master) (Session Normale) (S2-2019-2020) (1).pdf | 2020-09-22 22:10 | 433K | |
![[ ]](/icons/layout.gif) | Planning des contrôles (Master) (Session Normale) (S2-2019-2020).pdf | 2020-09-25 13:15 | 433K | |
![[ ]](/icons/layout.gif) | Planning des contrôles (Master) Biologie Animale.pdf | 2020-09-16 23:07 | 437K | |
![[ ]](/icons/layout.gif) | Planning des contrôles de Rattrapage Entomologie.pdf | 2020-09-03 12:38 | 337K | |
![[ ]](/icons/layout.gif) | Planning des contrôles de rattrapage L3 entomologie.pdf | 2020-11-04 14:43 | 144K | |
![[ ]](/icons/layout.gif) | Planning des contrôles de rattrapage M1 BCPI.pdf | 2020-11-04 14:43 | 143K | |
![[ ]](/icons/unknown.gif) | Planning des surveillances S2 2020 BA.xls | 2020-09-25 13:15 | 69K | |
![[ ]](/icons/layout.gif) | Polycopie Systématique des insectes L3 Entomologie.pdf | 2020-12-10 08:32 | 8.5M | |
![[ ]](/icons/layout.gif) | Programme de révision en présentiels - Département de Biologie Animale.pdf | 2020-09-16 23:06 | 123K | |
![[ ]](/icons/layout.gif) | Pv Corréctif Additif S2 Sess Normale Page 1.pdf | 2020-11-23 11:42 | 1.0M | |
![[ ]](/icons/layout.gif) | Pv Corréctif Additif S2 Sess Normale Page 2.pdf | 2020-11-23 11:42 | 563K | |
![[ ]](/icons/layout.gif) | Pv Corréctif Additif S2 Sess Normale Page 11.pdf | 2020-11-30 10:40 | 1.0M | |
![[ ]](/icons/layout.gif) | Pv Corréctif Additif S2 Sess Normale Page 21.pdf | 2020-11-30 10:40 | 563K | |
![[ ]](/icons/layout.gif) | Pv Corréctif Additif Sess Normale S2 Page 1.pdf | 2020-11-23 11:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Pv Corréctif Additif Sess Normale S2 Page 2.pdf | 2020-11-23 11:59 | 795K | |
![[ ]](/icons/layout.gif) | Pv Corréctif S5 Sess Normale p1.pdf | 2020-11-19 20:30 | 1.2M | |
![[ ]](/icons/layout.gif) | Pv Corréctif S5 Sess Normale p2.pdf | 2020-11-19 20:30 | 1.4M | |
![[ ]](/icons/layout.gif) | Pv Corréctif S5 Sess Ratt p1.pdf | 2020-11-19 20:30 | 1.3M | |
![[ ]](/icons/layout.gif) | Pv Corréctif S5 Sess Ratt p2.pdf | 2020-11-19 20:30 | 896K | |
![[ ]](/icons/layout.gif) | Pv Corréctif S6 Sess Normale p1.pdf | 2020-11-19 20:30 | 1.3M | |
![[ ]](/icons/layout.gif) | Pv Corréctif S6 Sess Normale p2.pdf | 2020-11-19 20:30 | 1.3M | |
![[ ]](/icons/layout.gif) | Pv Global Corréctif Additif Sess Normale Page 1.pdf | 2020-11-23 11:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Pv Global Corréctif Additif Sess Normale Page 2.pdf | 2020-11-23 11:42 | 426K | |
![[ ]](/icons/layout.gif) | Pv Global Corréctif Additif Sess Normale Page 11.pdf | 2020-11-30 10:40 | 1.1M | |
![[ ]](/icons/layout.gif) | Pv Global Corréctif Additif Sess Normale Page 21.pdf | 2020-11-30 10:40 | 426K | |
![[ ]](/icons/layout.gif) | Pv Global Corréctif Sess Normale p1.pdf | 2020-11-19 20:30 | 1.5M | |
![[ ]](/icons/layout.gif) | Pv Global Corréctif Sess Normale p2.pdf | 2020-11-19 20:30 | 1.2M | |
![[ ]](/icons/layout.gif) | Pv Global Correctif Additif Sess Normale Page 1.pdf | 2020-11-23 11:59 | 1.2M | |
![[ ]](/icons/layout.gif) | Pv Global Correctif Additif Sess Normale Page 2.pdf | 2020-11-23 11:59 | 513K | |
![[ ]](/icons/layout.gif) | Pv Global Sess Ratt.pdf | 2020-11-23 11:59 | 928K | |
![[ ]](/icons/layout.gif) | Pv Global Sess Ratt1.pdf | 2020-11-30 10:40 | 715K | |
![[ ]](/icons/layout.gif) | Pv Global Sess Ratt 239.pdf | 2020-11-23 11:42 | 715K | |
![[ ]](/icons/layout.gif) | Pv S1 Sess Ratt.pdf | 2020-11-23 11:42 | 763K | |
![[ ]](/icons/layout.gif) | Pv S1 Sess Ratt1.pdf | 2020-11-30 10:40 | 763K | |
![[ ]](/icons/layout.gif) | Pv S2 Sess Ratt.pdf | 2020-11-23 11:41 | 630K | |
![[ ]](/icons/layout.gif) | Pv S2 Sess Ratt1.pdf | 2020-11-30 10:40 | 630K | |
![[ ]](/icons/layout.gif) | Pv Sess Ratt S2.pdf | 2020-11-23 11:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Rapport bibliographique.pdf | 2020-12-11 23:43 | 922K | |
![[ ]](/icons/layout.gif) | S2 Session Ratt p1.pdf | 2020-11-19 20:29 | 1.7M | |
![[ ]](/icons/layout.gif) | S2 Session Ratt p2.pdf | 2020-11-19 20:29 | 924K | |
![[ ]](/icons/layout.gif) | S6 Immunologie p1.pdf | 2020-10-27 17:43 | 1.3M | |
![[ ]](/icons/layout.gif) | S6 Immunologie p2.pdf | 2020-10-27 17:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Scientific English Cours 1 L3 Immunology .pdf | 2020-12-04 10:36 | 491K | |
![[ ]](/icons/layout.gif) | Scientific English Cours 1 Master 2 Immunology .pdf | 2020-12-04 11:55 | 1.7M | |
![[ ]](/icons/layout.gif) | Structure des biomembranes.pdf | 2020-12-04 10:37 | 1.6M | |
![[ ]](/icons/layout.gif) | Systématique et écologie des insectes.pdf | 2020-12-11 23:44 | 6.1M | |
![[ ]](/icons/layout.gif) | TD Structure de l'ADN.pdf | 2020-11-30 10:25 | 472K | |
![[ ]](/icons/layout.gif) | TD les transferts génétique.pdf | 2020-11-30 10:25 | 630K | |
![[ ]](/icons/layout.gif) | TD les transposons.pdf | 2020-11-30 10:25 | 289K | |
![[ ]](/icons/layout.gif) | TP1=Histologie_M1.pdf | 2020-12-04 13:15 | 415K | |
![[ ]](/icons/layout.gif) | TP 1 PHARMACOLOGIE L3 TOXICOLOGIE 2020-2021 DEHILI.pdf | 2020-12-15 09:26 | 202K | |
![[ ]](/icons/layout.gif) | TP1_Histologie_M1.pdf | 2020-12-04 13:22 | 415K | |
![[ ]](/icons/layout.gif) | TP 2 PHARMACOLOGIE L3 TOXICOLOGIE 2020-2021 DEHILI.pdf | 2020-12-15 09:26 | 241K | |
![[ ]](/icons/layout.gif) | Travaux Pratiques de physiologie des grandes fonctions.pdf | 2020-12-15 09:26 | 2.9M | |
![[ ]](/icons/layout.gif) | analyse dARTICLE_M2.pdf | 2020-12-04 13:15 | 176K | |
![[ ]](/icons/layout.gif) | bio mol acides nucléiques, réplication.pdf | 2020-12-04 10:37 | 3.0M | |
![[ ]](/icons/layout.gif) | bio mol mutations de l'ADN, mécanismes de réparation.pdf | 2020-12-04 10:36 | 952K | |
![[ ]](/icons/layout.gif) | bio mol traduction.pdf | 2020-12-04 10:36 | 1.1M | |
![[ ]](/icons/layout.gif) | bio mol transcription de l'ARNm.pdf | 2020-12-04 10:36 | 1.4M | |
![[ ]](/icons/layout.gif) | caneva master génétique 2020.pdf | 2020-09-01 12:44 | 332K | |
![[ ]](/icons/layout.gif) | canneva licence génétique 2020.pdf | 2020-09-01 12:43 | 302K | |
![[ ]](/icons/layout.gif) | chapitre 1 structure d'ADN.pdf | 2020-11-30 10:25 | 505K | |
![[ ]](/icons/layout.gif) | chapitre 2 les plasmides et bactériophages.pdf | 2020-11-30 10:25 | 768K | |
![[ ]](/icons/layout.gif) | chapitre 3 les transferts génétique la conjugaison.pdf | 2020-11-30 10:25 | 333K | |
![[ ]](/icons/layout.gif) | chapitre 3 les transferts génétique la transformation et la transduction.pdf | 2020-11-30 10:25 | 235K | |
![[ ]](/icons/layout.gif) | chapitre 4 les transposons et les intégrons.pdf | 2020-11-30 10:25 | 368K | |
![[ ]](/icons/layout.gif) | cours d'apiculture.pdf | 2021-01-04 10:31 | 89K | |
![[ ]](/icons/layout.gif) | cours pesticides L3-2021.pdf | 2021-01-25 09:33 | 399K | |
![[ ]](/icons/layout.gif) | cours pré-stage 2020 MOSBAH Asma.pdf | 2020-12-15 09:26 | 669K | |
![[ ]](/icons/layout.gif) | polycopie du cours Régulation des gènes chez les procaryotes M1 génétique Mm GHARZOULI.pdf | 2020-11-30 10:25 | 1.8M | |
![[ ]](/icons/layout.gif) | polycopier Biologie du dévelopement_2°partie.pdf | 2020-12-28 10:40 | 3.9M | |
![[ ]](/icons/layout.gif) | polycopier génétique des eucaryotes.pdf | 2020-12-28 10:40 | 4.9M | |
![[ ]](/icons/layout.gif) | psychopédagogie_M2.pdf | 2020-12-04 13:15 | 95K | |
|